C10H9ClN2O — CID 118544434
7-chloro-2-ethylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 118544434) has the molecular formula C10H9ClN2O and a molecular weight of 208.65 g/mol. Its IUPAC name is 7-chloro-2-ethylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 7-chloro-2-ethylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 118544434 |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 7-chloro-2-ethylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCc1cc(=O)n2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C10H9ClN2O/c1-2-8-5-10(14)13-6-7(11)3-4-9(13)12-8/h3-6H,2H2,1H3 |
| InChIKey | WSXKAWUSSDTREL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |