C15H21N3O — CID 144970394
ethane;2-ethyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile (PubChem CID 144970394) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is ethane;2-ethyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile.
| Compound Name | ethane;2-ethyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile |
|---|---|
| PubChem CID | 144970394 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | ethane;2-ethyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile |
| SMILES | CC.CC.CCc1cc(=O)n2cc(C#N)ccc2n1 |
| InChI | InChI=1S/C11H9N3O.2C2H6/c1-2-9-5-11(15)14-7-8(6-12)3-4-10(14)13-9;2*1-2/h3-5,7H,2H2,1H3;2*1-2H3 |
| InChIKey | ZSIPARHPUCMXBQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |