C14H16N4O — CID 51098372
2-[ethyl-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]amino]acetonitrile (PubChem CID 51098372) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-[ethyl-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]amino]acetonitrile.
| Compound Name | 2-[ethyl-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]amino]acetonitrile |
|---|---|
| PubChem CID | 51098372 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-[ethyl-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]amino]acetonitrile |
| SMILES | CCN(CC#N)Cc1cc(=O)n2cc(C)ccc2n1 |
| InChI | InChI=1S/C14H16N4O/c1-3-17(7-6-15)10-12-8-14(19)18-9-11(2)4-5-13(18)16-12/h4-5,8-9H,3,7,10H2,1-2H3 |
| InChIKey | AHEJJMBYDKIHQY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 61.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|