C21H21F3N4O2 — CID 8001790
2-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 8001790) has the molecular formula C21H21F3N4O2 and a molecular weight of 418.42 g/mol. Its IUPAC name is 2-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 8001790 |
| Molecular Formula | C21H21F3N4O2 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)Cc1cc(=O)n2cc(C)ccc2n1 |
| InChI | InChI=1S/C21H21F3N4O2/c1-3-8-27(12-18(29)26-16-6-5-15(22)20(23)21(16)24)11-14-9-19(30)28-10-13(2)4-7-17(28)25-14/h4-7,9-10H,3,8,11-12H2,1-2H3,(H,26,29) |
| InChIKey | WHQBLNWBEHWEEI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|