C8H3Br2N3 — CID 126524032
2,3-dibromoimidazo[1,2-a]pyridine-6-carbonitrile (PubChem CID 126524032) has the molecular formula C8H3Br2N3 and a molecular weight of 300.94 g/mol. Its IUPAC name is 2,3-dibromoimidazo[1,2-a]pyridine-6-carbonitrile.
| Compound Name | 2,3-dibromoimidazo[1,2-a]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 126524032 |
| Molecular Formula | C8H3Br2N3 |
| Molecular Weight | 300.94 g/mol |
| Exact Mass | 298.87 |
| IUPAC Name | 2,3-dibromoimidazo[1,2-a]pyridine-6-carbonitrile |
| SMILES | N#Cc1ccc2nc(Br)c(Br)n2c1 |
| InChI | InChI=1S/C8H3Br2N3/c9-7-8(10)13-4-5(3-11)1-2-6(13)12-7/h1-2,4H |
| InChIKey | KGUBZMITDTUOTN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.94 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |