About 1,3-dimethylimidazo[1,5-a]pyridine-6-carbonitrile
1,3-dimethylimidazo[1,5-a]pyridine-6-carbonitrile (PubChem CID 130067723) has the molecular formula C10H9N3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 1,3-dimethylimidazo[1,5-a]pyridine-6-carbonitrile.
Analyze 1,3-dimethylimidazo[1,5-a]pyridine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylimidazo[1,5-a]pyridine-6-carbonitrile?
The IUPAC name of 1,3-dimethylimidazo[1,5-a]pyridine-6-carbonitrile (CID 130067723) is 1,3-dimethylimidazo[1,5-a]pyridine-6-carbonitrile.
What is the SMILES notation for 1,3-dimethylimidazo[1,5-a]pyridine-6-carbonitrile?
The canonical SMILES for 1,3-dimethylimidazo[1,5-a]pyridine-6-carbonitrile is Cc1nc(C)n2cc(C#N)ccc12.
What is the InChIKey of 1,3-dimethylimidazo[1,5-a]pyridine-6-carbonitrile?
The InChIKey is JBAQBPWRWGZQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3/c1-7-10-4-3-9(5-11)6-13(10)8(2)12-7/h3-4,6H,1-2H3.
What are the key properties of 1,3-dimethylimidazo[1,5-a]pyridine-6-carbonitrile?
1,3-dimethylimidazo[1,5-a]pyridine-6-carbonitrile has a molecular weight of 171.20 g/mol, XLogP of 1.82, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylimidazo[1,5-a]pyridine-6-carbonitrile is sourced from PubChem (CID 130067723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).