About 2-methyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile
2-methyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile (PubChem CID 142656814) has the molecular formula C10H7N3O
and a molecular weight of 185.19 g/mol. Its IUPAC name is 2-methyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile.
Analyze 2-methyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile?
The IUPAC name of 2-methyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile (CID 142656814) is 2-methyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile.
What is the SMILES notation for 2-methyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile?
The canonical SMILES for 2-methyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile is Cc1cc(=O)n2cc(C#N)ccc2n1.
What is the InChIKey of 2-methyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile?
The InChIKey is BRSQCIDAAQHBTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O/c1-7-4-10(14)13-6-8(5-11)2-3-9(13)12-7/h2-4,6H,1H3.
What are the key properties of 2-methyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile?
2-methyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile has a molecular weight of 185.19 g/mol, XLogP of 0.87, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-oxopyrido[1,2-a]pyrimidine-7-carbonitrile is sourced from PubChem (CID 142656814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).