C15H8N4S — CID 122229422
(6-cyano-2-phenylimidazo[1,2-a]pyridin-3-yl) thiocyanate (PubChem CID 122229422) has the molecular formula C15H8N4S and a molecular weight of 276.32 g/mol. Its IUPAC name is (6-cyano-2-phenylimidazo[1,2-a]pyridin-3-yl) thiocyanate.
| Compound Name | (6-cyano-2-phenylimidazo[1,2-a]pyridin-3-yl) thiocyanate |
|---|---|
| PubChem CID | 122229422 |
| Molecular Formula | C15H8N4S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | (6-cyano-2-phenylimidazo[1,2-a]pyridin-3-yl) thiocyanate |
| SMILES | N#CSc1c(-c2ccccc2)nc2ccc(C#N)cn12 |
| InChI | InChI=1S/C15H8N4S/c16-8-11-6-7-13-18-14(12-4-2-1-3-5-12)15(20-10-17)19(13)9-11/h1-7,9H |
| InChIKey | BOLCIUJWQWUQDK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|