C14H8ClN3S — CID 162411635
(7-chloro-2-phenylimidazo[1,2-a]pyridin-3-yl) thiocyanate (PubChem CID 162411635) has the molecular formula C14H8ClN3S and a molecular weight of 285.76 g/mol. Its IUPAC name is (7-chloro-2-phenylimidazo[1,2-a]pyridin-3-yl) thiocyanate.
| Compound Name | (7-chloro-2-phenylimidazo[1,2-a]pyridin-3-yl) thiocyanate |
|---|---|
| PubChem CID | 162411635 |
| Molecular Formula | C14H8ClN3S |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | (7-chloro-2-phenylimidazo[1,2-a]pyridin-3-yl) thiocyanate |
| SMILES | N#CSc1c(-c2ccccc2)nc2cc(Cl)ccn12 |
| InChI | InChI=1S/C14H8ClN3S/c15-11-6-7-18-12(8-11)17-13(14(18)19-9-16)10-4-2-1-3-5-10/h1-8H |
| InChIKey | WDXONFAWNZXETF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|