C14H7ClN4O2 — CID 82343145
7-chloro-2-(4-nitrophenyl)imidazo[1,2-a]pyridine-3-carbonitrile (PubChem CID 82343145) has the molecular formula C14H7ClN4O2 and a molecular weight of 298.69 g/mol. Its IUPAC name is 7-chloro-2-(4-nitrophenyl)imidazo[1,2-a]pyridine-3-carbonitrile.
| Compound Name | 7-chloro-2-(4-nitrophenyl)imidazo[1,2-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 82343145 |
| Molecular Formula | C14H7ClN4O2 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 7-chloro-2-(4-nitrophenyl)imidazo[1,2-a]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc([N+](=O)[O-])cc2)nc2cc(Cl)ccn12 |
| InChI | InChI=1S/C14H7ClN4O2/c15-10-5-6-18-12(8-16)14(17-13(18)7-10)9-1-3-11(4-2-9)19(20)21/h1-7H |
| InChIKey | GXOMCPPWQIWBPS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|