C11H7N5O2S3 — CID 10520917
(6-phenyl-2-sulfamoylimidazo[2,1-b][1,3,4]thiadiazol-5-yl) thiocyanate (PubChem CID 10520917) has the molecular formula C11H7N5O2S3 and a molecular weight of 337.41 g/mol. Its IUPAC name is (6-phenyl-2-sulfamoylimidazo[2,1-b][1,3,4]thiadiazol-5-yl) thiocyanate.
| Compound Name | (6-phenyl-2-sulfamoylimidazo[2,1-b][1,3,4]thiadiazol-5-yl) thiocyanate |
|---|---|
| PubChem CID | 10520917 |
| Molecular Formula | C11H7N5O2S3 |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | (6-phenyl-2-sulfamoylimidazo[2,1-b][1,3,4]thiadiazol-5-yl) thiocyanate |
| SMILES | N#CSc1c(-c2ccccc2)nc2sc(S(N)(=O)=O)nn12 |
| InChI | InChI=1S/C11H7N5O2S3/c12-6-19-9-8(7-4-2-1-3-5-7)14-10-16(9)15-11(20-10)21(13,17)18/h1-5H,(H2,13,17,18) |
| InChIKey | QRWBDWGMQWBLHY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|