C15H13N3OS2 — CID 138982743
[2-(1-hydroxyethyl)-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-yl] thiocyanate (PubChem CID 138982743) has the molecular formula C15H13N3OS2 and a molecular weight of 315.42 g/mol. Its IUPAC name is [2-(1-hydroxyethyl)-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-yl] thiocyanate.
| Compound Name | [2-(1-hydroxyethyl)-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-yl] thiocyanate |
|---|---|
| PubChem CID | 138982743 |
| Molecular Formula | C15H13N3OS2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | [2-(1-hydroxyethyl)-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazol-5-yl] thiocyanate |
| SMILES | Cc1c(C(C)O)sc2nc(-c3ccccc3)c(SC#N)n12 |
| InChI | InChI=1S/C15H13N3OS2/c1-9-13(10(2)19)21-15-17-12(11-6-4-3-5-7-11)14(18(9)15)20-8-16/h3-7,10,19H,1-2H3 |
| InChIKey | UIDRDVBUGNQCMM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 61.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|