C14H16N2S — CID 144628970
ethane;5-methyl-6-phenylimidazo[2,1-b][1,3]thiazole (PubChem CID 144628970) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is ethane;5-methyl-6-phenylimidazo[2,1-b][1,3]thiazole.
| Compound Name | ethane;5-methyl-6-phenylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 144628970 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | ethane;5-methyl-6-phenylimidazo[2,1-b][1,3]thiazole |
| SMILES | CC.Cc1c(-c2ccccc2)nc2sccn12 |
| InChI | InChI=1S/C12H10N2S.C2H6/c1-9-11(10-5-3-2-4-6-10)13-12-14(9)7-8-15-12;1-2/h2-8H,1H3;1-2H3 |
| InChIKey | IGMFIHWYUUMYSX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |