About ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate
ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate (PubChem CID 10802132) has the molecular formula C14H12N2O2S
and a molecular weight of 272.33 g/mol. Its IUPAC name is ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate |
| PubChem CID | 10802132 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)nc2sccn12 |
| InChI | InChI=1S/C14H12N2O2S/c1-2-18-13(17)12-11(10-6-4-3-5-7-10)15-14-16(12)8-9-19-14/h3-9H,2H2,1H3 |
| InChIKey | OBUVCJKNVNDWCT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate?
The IUPAC name of ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate (CID 10802132) is ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate.
What is the SMILES notation for ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate?
The canonical SMILES for ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate is CCOC(=O)c1c(-c2ccccc2)nc2sccn12.
What is the InChIKey of ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate?
The InChIKey is OBUVCJKNVNDWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2S/c1-2-18-13(17)12-11(10-6-4-3-5-7-10)15-14-16(12)8-9-19-14/h3-9H,2H2,1H3.
What are the key properties of ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate?
ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate has a molecular weight of 272.33 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate is sourced from PubChem (CID 10802132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).