C32H30N4O4S2 — CID 11592429
8-(6-phenylimidazo[2,1-b][1,3]thiazole-5-carbonyl)oxyoctyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate (PubChem CID 11592429) has the molecular formula C32H30N4O4S2 and a molecular weight of 598.75 g/mol. Its IUPAC name is 8-(6-phenylimidazo[2,1-b][1,3]thiazole-5-carbonyl)oxyoctyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate.
| Compound Name | 8-(6-phenylimidazo[2,1-b][1,3]thiazole-5-carbonyl)oxyoctyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate |
|---|---|
| PubChem CID | 11592429 |
| Molecular Formula | C32H30N4O4S2 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | 8-(6-phenylimidazo[2,1-b][1,3]thiazole-5-carbonyl)oxyoctyl 6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylate |
| SMILES | O=C(OCCCCCCCCOC(=O)c1c(-c2ccccc2)nc2sccn12)c1c(-c2ccccc2)nc2sccn12 |
| InChI | InChI=1S/C32H30N4O4S2/c37-29(27-25(23-13-7-5-8-14-23)33-31-35(27)17-21-41-31)39-19-11-3-1-2-4-12-20-40-30(38)28-26(24-15-9-6-10-16-24)34-32-36(28)18-22-42-32/h5-10,13-18,21-22H,1-4,11-12,19-20H2 |
| InChIKey | POWMIFGWAYAWBZ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|