C22H23N5O2S — CID 155264329
(Z)-2-[amino-[(3,4-dimethoxyphenyl)methyl]amino]-1-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)ethenamine (PubChem CID 155264329) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is (Z)-2-[amino-[(3,4-dimethoxyphenyl)methyl]amino]-1-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)ethenamine.
| Compound Name | (Z)-2-[amino-[(3,4-dimethoxyphenyl)methyl]amino]-1-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)ethenamine |
|---|---|
| PubChem CID | 155264329 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | (Z)-2-[amino-[(3,4-dimethoxyphenyl)methyl]amino]-1-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)ethenamine |
| SMILES | COc1ccc(CN(N)/C=C(\N)c2c(-c3ccccc3)nc3sccn23)cc1OC |
| InChI | InChI=1S/C22H23N5O2S/c1-28-18-9-8-15(12-19(18)29-2)13-26(24)14-17(23)21-20(16-6-4-3-5-7-16)25-22-27(21)10-11-30-22/h3-12,14H,13,23-24H2,1-2H3/b17-14- |
| InChIKey | ILDASSSZVOTQDL-VKAVYKQESA-N |
| XLogP | 3.71 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|