6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid

C12H8N2O3S — CID 43475881

IUPAC6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid
SMILESO=C(O)c1c(Oc2ccccc2)nc2sccn12
InChIInChI=1S/C12H8N2O3S/c15-11(16)9-10(13-12-14(9)6-7-18-12)17-8-4-2-1-3-5-8/h1-7H,(H,15,16)
InChIKeyGEELTGWCOCWQMJ-UHFFFAOYSA-N
MW260.27 g/mol
LogP2.89
Rot. Bonds3

About 6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid

6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid (PubChem CID 43475881) has the molecular formula C12H8N2O3S and a molecular weight of 260.27 g/mol. Its IUPAC name is 6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid.

Molecular Properties

Compound Name6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid
PubChem CID43475881
Molecular FormulaC12H8N2O3S
Molecular Weight260.27 g/mol
Exact Mass260.03
IUPAC Name6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid
SMILESO=C(O)c1c(Oc2ccccc2)nc2sccn12
InChIInChI=1S/C12H8N2O3S/c15-11(16)9-10(13-12-14(9)6-7-18-12)17-8-4-2-1-3-5-8/h1-7H,(H,15,16)
InChIKeyGEELTGWCOCWQMJ-UHFFFAOYSA-N
XLogP2.89
TPSA63.83 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.27
LogP ≤ 52.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The IUPAC name of 6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid (CID 43475881) is 6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid.
What is the SMILES notation for 6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The canonical SMILES for 6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid is O=C(O)c1c(Oc2ccccc2)nc2sccn12.
What is the InChIKey of 6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The InChIKey is GEELTGWCOCWQMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O3S/c15-11(16)9-10(13-12-14(9)6-7-18-12)17-8-4-2-1-3-5-8/h1-7H,(H,15,16).
What are the key properties of 6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid has a molecular weight of 260.27 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid is sourced from PubChem (CID 43475881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).