C12H8N2O3S — CID 43475881
6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid (PubChem CID 43475881) has the molecular formula C12H8N2O3S and a molecular weight of 260.27 g/mol. Its IUPAC name is 6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid.
| Compound Name | 6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 43475881 |
| Molecular Formula | C12H8N2O3S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 6-phenoxyimidazo[2,1-b][1,3]thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1c(Oc2ccccc2)nc2sccn12 |
| InChI | InChI=1S/C12H8N2O3S/c15-11(16)9-10(13-12-14(9)6-7-18-12)17-8-4-2-1-3-5-8/h1-7H,(H,15,16) |
| InChIKey | GEELTGWCOCWQMJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |