About 6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid
6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid (PubChem CID 64780586) has the molecular formula C10H7N5O3S
and a molecular weight of 277.27 g/mol. Its IUPAC name is 6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid |
| PubChem CID | 64780586 |
| Molecular Formula | C10H7N5O3S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid |
| SMILES | NC(=O)c1ccn(-c2nc3sccn3c2C(=O)O)n1 |
| InChI | InChI=1S/C10H7N5O3S/c11-7(16)5-1-2-15(13-5)8-6(9(17)18)14-3-4-19-10(14)12-8/h1-4H,(H2,11,16)(H,17,18) |
| InChIKey | YUHLZNFNFPKWBF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 115.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The IUPAC name of 6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid (CID 64780586) is 6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid.
What is the SMILES notation for 6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The canonical SMILES for 6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid is NC(=O)c1ccn(-c2nc3sccn3c2C(=O)O)n1.
What is the InChIKey of 6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The InChIKey is YUHLZNFNFPKWBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N5O3S/c11-7(16)5-1-2-15(13-5)8-6(9(17)18)14-3-4-19-10(14)12-8/h1-4H,(H2,11,16)(H,17,18).
What are the key properties of 6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid has a molecular weight of 277.27 g/mol, XLogP of 0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-carbamoylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid is sourced from PubChem (CID 64780586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).