C10H9N7OS — CID 103335990
1-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)pyrazole-3-carboxamide (PubChem CID 103335990) has the molecular formula C10H9N7OS and a molecular weight of 275.30 g/mol. Its IUPAC name is 1-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)pyrazole-3-carboxamide.
| Compound Name | 1-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 103335990 |
| Molecular Formula | C10H9N7OS |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 1-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)pyrazole-3-carboxamide |
| SMILES | NNc1nc(-n2ccc(C(N)=O)n2)c2ccsc2n1 |
| InChI | InChI=1S/C10H9N7OS/c11-7(18)6-1-3-17(16-6)8-5-2-4-19-9(5)14-10(13-8)15-12/h1-4H,12H2,(H2,11,18)(H,13,14,15) |
| InChIKey | KCFVWGSXDFSHSM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|