C10H13N5OS2 — CID 103332909
[4-(1-oxo-1,4-thiazinan-4-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103332909) has the molecular formula C10H13N5OS2 and a molecular weight of 283.38 g/mol. Its IUPAC name is [4-(1-oxo-1,4-thiazinan-4-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(1-oxo-1,4-thiazinan-4-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103332909 |
| Molecular Formula | C10H13N5OS2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | [4-(1-oxo-1,4-thiazinan-4-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | NNc1nc(N2CCS(=O)CC2)c2ccsc2n1 |
| InChI | InChI=1S/C10H13N5OS2/c11-14-10-12-8(7-1-4-17-9(7)13-10)15-2-5-18(16)6-3-15/h1,4H,2-3,5-6,11H2,(H,12,13,14) |
| InChIKey | GWFGEOBQJYFHTK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|