C12H17N5S2 — CID 103335812
[4-(2,2-dimethylthiomorpholin-4-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103335812) has the molecular formula C12H17N5S2 and a molecular weight of 295.44 g/mol. Its IUPAC name is [4-(2,2-dimethylthiomorpholin-4-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(2,2-dimethylthiomorpholin-4-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103335812 |
| Molecular Formula | C12H17N5S2 |
| Molecular Weight | 295.44 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | [4-(2,2-dimethylthiomorpholin-4-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | CC1(C)CN(c2nc(NN)nc3sccc23)CCS1 |
| InChI | InChI=1S/C12H17N5S2/c1-12(2)7-17(4-6-19-12)9-8-3-5-18-10(8)15-11(14-9)16-13/h3,5H,4,6-7,13H2,1-2H3,(H,14,15,16) |
| InChIKey | LPECEEVWNGVRDE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|