C7H8N4S2 — CID 103336570
(4-methylsulfanylthieno[2,3-d]pyrimidin-2-yl)hydrazine (PubChem CID 103336570) has the molecular formula C7H8N4S2 and a molecular weight of 212.30 g/mol. Its IUPAC name is (4-methylsulfanylthieno[2,3-d]pyrimidin-2-yl)hydrazine.
| Compound Name | (4-methylsulfanylthieno[2,3-d]pyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 103336570 |
| Molecular Formula | C7H8N4S2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | (4-methylsulfanylthieno[2,3-d]pyrimidin-2-yl)hydrazine |
| SMILES | CSc1nc(NN)nc2sccc12 |
| InChI | InChI=1S/C7H8N4S2/c1-12-5-4-2-3-13-6(4)10-7(9-5)11-8/h2-3H,8H2,1H3,(H,9,10,11) |
| InChIKey | NNGWVRMTMZMCQR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|