About fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine
fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine (PubChem CID 70481252) has the molecular formula C8H16B4F4N2O8S2
and a molecular weight of 451.60 g/mol. Its IUPAC name is fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine |
| PubChem CID | 70481252 |
| Molecular Formula | C8H16B4F4N2O8S2 |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine |
| SMILES | CSc1nc(C)nc2sccc12.OB(O)F.OB(O)F.OB(O)F.OB(O)F |
| InChI | InChI=1S/C8H8N2S2.4BFH2O2/c1-5-9-7(11-2)6-3-4-12-8(6)10-5;4*2-1(3)4/h3-4H,1-2H3;4*3-4H |
| InChIKey | HCCQLNNIEGRAMY-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 187.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine?
The IUPAC name of fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine (CID 70481252) is fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine.
What is the SMILES notation for fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine?
The canonical SMILES for fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine is CSc1nc(C)nc2sccc12.OB(O)F.OB(O)F.OB(O)F.OB(O)F.
What is the InChIKey of fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine?
The InChIKey is HCCQLNNIEGRAMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S2.4BFH2O2/c1-5-9-7(11-2)6-3-4-12-8(6)10-5;4*2-1(3)4/h3-4H,1-2H3;4*3-4H.
What are the key properties of fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine?
fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine has a molecular weight of 451.60 g/mol, XLogP of -1.58, 1 rotatable bonds, 8 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine is sourced from PubChem (CID 70481252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).