C8H16B4F4N2O8S2 — CID 70481252
fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine (PubChem CID 70481252) has the molecular formula C8H16B4F4N2O8S2 and a molecular weight of 451.60 g/mol. Its IUPAC name is fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine.
| Compound Name | fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 70481252 |
| Molecular Formula | C8H16B4F4N2O8S2 |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | fluoroboronic acid;2-methyl-4-methylsulfanylthieno[2,3-d]pyrimidine |
| SMILES | CSc1nc(C)nc2sccc12.OB(O)F.OB(O)F.OB(O)F.OB(O)F |
| InChI | InChI=1S/C8H8N2S2.4BFH2O2/c1-5-9-7(11-2)6-3-4-12-8(6)10-5;4*2-1(3)4/h3-4H,1-2H3;4*3-4H |
| InChIKey | HCCQLNNIEGRAMY-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 187.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|