C10H13N3S2 — CID 103334167
4-tert-butylsulfanylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103334167) has the molecular formula C10H13N3S2 and a molecular weight of 239.37 g/mol. Its IUPAC name is 4-tert-butylsulfanylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-tert-butylsulfanylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103334167 |
| Molecular Formula | C10H13N3S2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 4-tert-butylsulfanylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CC(C)(C)Sc1nc(N)nc2sccc12 |
| InChI | InChI=1S/C10H13N3S2/c1-10(2,3)15-8-6-4-5-14-7(6)12-9(11)13-8/h4-5H,1-3H3,(H2,11,12,13) |
| InChIKey | CZZFPPHCOBLCQB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |