C11H16N4S — CID 103324290
4-N-(3-methylbutyl)thieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103324290) has the molecular formula C11H16N4S and a molecular weight of 236.34 g/mol. Its IUPAC name is 4-N-(3-methylbutyl)thieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-methylbutyl)thieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103324290 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 4-N-(3-methylbutyl)thieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CC(C)CCNc1nc(N)nc2sccc12 |
| InChI | InChI=1S/C11H16N4S/c1-7(2)3-5-13-9-8-4-6-16-10(8)15-11(12)14-9/h4,6-7H,3,5H2,1-2H3,(H3,12,13,14,15) |
| InChIKey | CQHLWYYDYGPXRM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |