C9H11N5OS — CID 103325001
2-[(2-aminothieno[2,3-d]pyrimidin-4-yl)amino]propanamide (PubChem CID 103325001) has the molecular formula C9H11N5OS and a molecular weight of 237.29 g/mol. Its IUPAC name is 2-[(2-aminothieno[2,3-d]pyrimidin-4-yl)amino]propanamide.
| Compound Name | 2-[(2-aminothieno[2,3-d]pyrimidin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 103325001 |
| Molecular Formula | C9H11N5OS |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-[(2-aminothieno[2,3-d]pyrimidin-4-yl)amino]propanamide |
| SMILES | CC(Nc1nc(N)nc2sccc12)C(N)=O |
| InChI | InChI=1S/C9H11N5OS/c1-4(6(10)15)12-7-5-2-3-16-8(5)14-9(11)13-7/h2-4H,1H3,(H2,10,15)(H3,11,12,13,14) |
| InChIKey | VWTUDJUFLSQQNZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |