C11H16N4OS — CID 114148662
5-[(2-aminothieno[2,3-d]pyrimidin-4-yl)amino]pentan-2-ol (PubChem CID 114148662) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is 5-[(2-aminothieno[2,3-d]pyrimidin-4-yl)amino]pentan-2-ol.
| Compound Name | 5-[(2-aminothieno[2,3-d]pyrimidin-4-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 114148662 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 5-[(2-aminothieno[2,3-d]pyrimidin-4-yl)amino]pentan-2-ol |
| SMILES | CC(O)CCCNc1nc(N)nc2sccc12 |
| InChI | InChI=1S/C11H16N4OS/c1-7(16)3-2-5-13-9-8-4-6-17-10(8)15-11(12)14-9/h4,6-7,16H,2-3,5H2,1H3,(H3,12,13,14,15) |
| InChIKey | FKCGLJHQQSCJFU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|