C9H12N4S — CID 103324043
4-N-propylthieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103324043) has the molecular formula C9H12N4S and a molecular weight of 208.29 g/mol. Its IUPAC name is 4-N-propylthieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-propylthieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103324043 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 4-N-propylthieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCCNc1nc(N)nc2sccc12 |
| InChI | InChI=1S/C9H12N4S/c1-2-4-11-7-6-3-5-14-8(6)13-9(10)12-7/h3,5H,2,4H2,1H3,(H3,10,11,12,13) |
| InChIKey | QOJGJYOQQMIPOG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |