C12H9N5O2S2 — CID 103336539
[4-(2-nitrophenyl)sulfanylthieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103336539) has the molecular formula C12H9N5O2S2 and a molecular weight of 319.37 g/mol. Its IUPAC name is [4-(2-nitrophenyl)sulfanylthieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(2-nitrophenyl)sulfanylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103336539 |
| Molecular Formula | C12H9N5O2S2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | [4-(2-nitrophenyl)sulfanylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | NNc1nc(Sc2ccccc2[N+](=O)[O-])c2ccsc2n1 |
| InChI | InChI=1S/C12H9N5O2S2/c13-16-12-14-10-7(5-6-20-10)11(15-12)21-9-4-2-1-3-8(9)17(18)19/h1-6H,13H2,(H,14,15,16) |
| InChIKey | XECZDUNKSLQBME-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|