C8H4ClN3O2S2 — CID 43808370
3-chloro-4-(2-nitrophenyl)sulfanyl-1,2,5-thiadiazole (PubChem CID 43808370) has the molecular formula C8H4ClN3O2S2 and a molecular weight of 273.73 g/mol. Its IUPAC name is 3-chloro-4-(2-nitrophenyl)sulfanyl-1,2,5-thiadiazole.
| Compound Name | 3-chloro-4-(2-nitrophenyl)sulfanyl-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 43808370 |
| Molecular Formula | C8H4ClN3O2S2 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 272.94 |
| IUPAC Name | 3-chloro-4-(2-nitrophenyl)sulfanyl-1,2,5-thiadiazole |
| SMILES | O=[N+]([O-])c1ccccc1Sc1nsnc1Cl |
| InChI | InChI=1S/C8H4ClN3O2S2/c9-7-8(11-16-10-7)15-6-4-2-1-3-5(6)12(13)14/h1-4H |
| InChIKey | VQLPHTGJIHLWFG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|