C11H10ClN5O2S — CID 62865447
4-chloro-N,N-dimethyl-6-(2-nitrophenyl)sulfanyl-1,3,5-triazin-2-amine (PubChem CID 62865447) has the molecular formula C11H10ClN5O2S and a molecular weight of 311.75 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-6-(2-nitrophenyl)sulfanyl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N,N-dimethyl-6-(2-nitrophenyl)sulfanyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62865447 |
| Molecular Formula | C11H10ClN5O2S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 4-chloro-N,N-dimethyl-6-(2-nitrophenyl)sulfanyl-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1nc(Cl)nc(Sc2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H10ClN5O2S/c1-16(2)10-13-9(12)14-11(15-10)20-8-6-4-3-5-7(8)17(18)19/h3-6H,1-2H3 |
| InChIKey | DPOJDMPMJPESOA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 85.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|