C9H9N7S2 — CID 103336692
[4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]thieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103336692) has the molecular formula C9H9N7S2 and a molecular weight of 279.35 g/mol. Its IUPAC name is [4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]thieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]thieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103336692 |
| Molecular Formula | C9H9N7S2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | [4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]thieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | Cn1ncnc1Sc1nc(NN)nc2sccc12 |
| InChI | InChI=1S/C9H9N7S2/c1-16-9(11-4-12-16)18-7-5-2-3-17-6(5)13-8(14-7)15-10/h2-4H,10H2,1H3,(H,13,14,15) |
| InChIKey | BJTLTIKGJHCBTL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|