C15H18N3S+ — CID 4880467
trimethyl-[(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]azanium (PubChem CID 4880467) has the molecular formula C15H18N3S+ and a molecular weight of 272.40 g/mol. Its IUPAC name is trimethyl-[(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]azanium.
| Compound Name | trimethyl-[(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]azanium |
|---|---|
| PubChem CID | 4880467 |
| Molecular Formula | C15H18N3S+ |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | trimethyl-[(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]azanium |
| SMILES | C[N+](C)(C)Cc1c(-c2ccccc2)nc2sccn12 |
| InChI | InChI=1S/C15H18N3S/c1-18(2,3)11-13-14(12-7-5-4-6-8-12)16-15-17(13)9-10-19-15/h4-10H,11H2,1-3H3/q+1 |
| InChIKey | VKXMDBNBTPJZBW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|