C12H9BN2OS — CID 89392602
CID 89392602 (PubChem CID 89392602) has the molecular formula C12H9BN2OS and a molecular weight of 240.10 g/mol.
| Compound Name | CID 89392602 |
|---|---|
| PubChem CID | 89392602 |
| Molecular Formula | C12H9BN2OS |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2nc3sccn3c2CO)cc1 |
| InChI | InChI=1S/C12H9BN2OS/c13-9-3-1-8(2-4-9)11-10(7-16)15-5-6-17-12(15)14-11/h1-6,16H,7H2 |
| InChIKey | VTGWTLOMXALFPU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|