C16H14N2O3 — CID 21280357
ethyl 2-(4-hydroxyphenyl)imidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 21280357) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is ethyl 2-(4-hydroxyphenyl)imidazo[1,2-a]pyridine-3-carboxylate.
| Compound Name | ethyl 2-(4-hydroxyphenyl)imidazo[1,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 21280357 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | ethyl 2-(4-hydroxyphenyl)imidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(O)cc2)nc2ccccn12 |
| InChI | InChI=1S/C16H14N2O3/c1-2-21-16(20)15-14(11-6-8-12(19)9-7-11)17-13-5-3-4-10-18(13)15/h3-10,19H,2H2,1H3 |
| InChIKey | PCBOHMZPXPZYOX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |