C19H15N3O2 — CID 10591570
ethyl 3-phenyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene-5-carboxylate (PubChem CID 10591570) has the molecular formula C19H15N3O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is ethyl 3-phenyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene-5-carboxylate.
| Compound Name | ethyl 3-phenyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 10591570 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | ethyl 3-phenyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2nc3ccccn3c2c(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H15N3O2/c1-2-24-19(23)15-12-14-18(22-11-7-6-10-16(22)20-14)17(21-15)13-8-4-3-5-9-13/h3-12H,2H2,1H3 |
| InChIKey | VYMPNDPRGHIVCA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |