C12H12N2O4 — CID 134969291
2-(2-ethoxycarbonylimidazo[1,2-a]pyridin-3-yl)acetic acid (PubChem CID 134969291) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 2-(2-ethoxycarbonylimidazo[1,2-a]pyridin-3-yl)acetic acid.
| Compound Name | 2-(2-ethoxycarbonylimidazo[1,2-a]pyridin-3-yl)acetic acid |
|---|---|
| PubChem CID | 134969291 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-(2-ethoxycarbonylimidazo[1,2-a]pyridin-3-yl)acetic acid |
| SMILES | CCOC(=O)c1nc2ccccn2c1CC(=O)O |
| InChI | InChI=1S/C12H12N2O4/c1-2-18-12(17)11-8(7-10(15)16)14-6-4-3-5-9(14)13-11/h3-6H,2,7H2,1H3,(H,15,16) |
| InChIKey | PVZYLJOKBGTVEY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |