C15H9ClF8N2O2 — CID 10789086
ethyl 2-[(E)-5-chloro-1,2,3,3,4,4,5,5-octafluoropent-1-enyl]imidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 10789086) has the molecular formula C15H9ClF8N2O2 and a molecular weight of 436.69 g/mol. Its IUPAC name is ethyl 2-[(E)-5-chloro-1,2,3,3,4,4,5,5-octafluoropent-1-enyl]imidazo[1,2-a]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[(E)-5-chloro-1,2,3,3,4,4,5,5-octafluoropent-1-enyl]imidazo[1,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10789086 |
| Molecular Formula | C15H9ClF8N2O2 |
| Molecular Weight | 436.69 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | ethyl 2-[(E)-5-chloro-1,2,3,3,4,4,5,5-octafluoropent-1-enyl]imidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(/C(F)=C(\F)C(F)(F)C(F)(F)C(F)(F)Cl)nc2ccccn12 |
| InChI | InChI=1S/C15H9ClF8N2O2/c1-2-28-12(27)10-9(25-7-5-3-4-6-26(7)10)8(17)11(18)13(19,20)14(21,22)15(16,23)24/h3-6H,2H2,1H3/b11-8+ |
| InChIKey | OKFJVBZKYIMYQP-DHZHZOJOSA-N |
| XLogP | 5.22 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.69 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|