C19H14N2OS2 — CID 163359892
(E)-1-(4-methylthiophen-3-yl)-3-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-en-1-one (PubChem CID 163359892) has the molecular formula C19H14N2OS2 and a molecular weight of 350.47 g/mol. Its IUPAC name is (E)-1-(4-methylthiophen-3-yl)-3-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-methylthiophen-3-yl)-3-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 163359892 |
| Molecular Formula | C19H14N2OS2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | (E)-1-(4-methylthiophen-3-yl)-3-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-en-1-one |
| SMILES | Cc1cscc1C(=O)/C=C/c1c(-c2ccccc2)nc2sccn12 |
| InChI | InChI=1S/C19H14N2OS2/c1-13-11-23-12-15(13)17(22)8-7-16-18(14-5-3-2-4-6-14)20-19-21(16)9-10-24-19/h2-12H,1H3/b8-7+ |
| InChIKey | GPYCJLOHRWEKAU-BQYQJAHWSA-N |
| XLogP | 5.33 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|