About N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine
N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine (PubChem CID 115625717) has the molecular formula C14H20ClN3
and a molecular weight of 265.79 g/mol. Its IUPAC name is N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine |
| PubChem CID | 115625717 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine |
| SMILES | CC(NCc1cn2cc(Cl)ccc2n1)C(C)(C)C |
| InChI | InChI=1S/C14H20ClN3/c1-10(14(2,3)4)16-7-12-9-18-8-11(15)5-6-13(18)17-12/h5-6,8-10,16H,7H2,1-4H3 |
| InChIKey | MHVBKJSZIRIZGL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine?
The IUPAC name of N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine (CID 115625717) is N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine.
What is the SMILES notation for N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine?
The canonical SMILES for N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine is CC(NCc1cn2cc(Cl)ccc2n1)C(C)(C)C.
What is the InChIKey of N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine?
The InChIKey is MHVBKJSZIRIZGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClN3/c1-10(14(2,3)4)16-7-12-9-18-8-11(15)5-6-13(18)17-12/h5-6,8-10,16H,7H2,1-4H3.
What are the key properties of N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine?
N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine has a molecular weight of 265.79 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3,3-dimethylbutan-2-amine is sourced from PubChem (CID 115625717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).