C12H19NO2S — CID 116891437
methyl 2-(2-tert-butyl-1,3-thiazol-4-yl)butanoate (PubChem CID 116891437) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is methyl 2-(2-tert-butyl-1,3-thiazol-4-yl)butanoate.
| Compound Name | methyl 2-(2-tert-butyl-1,3-thiazol-4-yl)butanoate |
|---|---|
| PubChem CID | 116891437 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | methyl 2-(2-tert-butyl-1,3-thiazol-4-yl)butanoate |
| SMILES | CCC(C(=O)OC)c1csc(C(C)(C)C)n1 |
| InChI | InChI=1S/C12H19NO2S/c1-6-8(10(14)15-5)9-7-16-11(13-9)12(2,3)4/h7-8H,6H2,1-5H3 |
| InChIKey | LRBLKTJWABXPOD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |