About 2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione
2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione (PubChem CID 19761179) has the molecular formula C13H11N3O2S
and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione |
| PubChem CID | 19761179 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione |
| SMILES | CC(c1csc(N)n1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H11N3O2S/c1-7(10-6-19-13(14)15-10)16-11(17)8-4-2-3-5-9(8)12(16)18/h2-7H,1H3,(H2,14,15) |
| InChIKey | GZWZGGZVXMUPTC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione?
The IUPAC name of 2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione (CID 19761179) is 2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione.
What is the SMILES notation for 2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione?
The canonical SMILES for 2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione is CC(c1csc(N)n1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione?
The InChIKey is GZWZGGZVXMUPTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O2S/c1-7(10-6-19-13(14)15-10)16-11(17)8-4-2-3-5-9(8)12(16)18/h2-7H,1H3,(H2,14,15).
What are the key properties of 2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione?
2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione has a molecular weight of 273.32 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-amino-1,3-thiazol-4-yl)ethyl]isoindole-1,3-dione is sourced from PubChem (CID 19761179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).