C14H13N7O2S2 — CID 24830655
2-[4-methyl-5-[2-(4-nitroanilino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]guanidine (PubChem CID 24830655) has the molecular formula C14H13N7O2S2 and a molecular weight of 375.44 g/mol. Its IUPAC name is 2-[4-methyl-5-[2-(4-nitroanilino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-methyl-5-[2-(4-nitroanilino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 24830655 |
| Molecular Formula | C14H13N7O2S2 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 2-[4-methyl-5-[2-(4-nitroanilino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]guanidine |
| SMILES | Cc1nc(N=C(N)N)sc1-c1csc(Nc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C14H13N7O2S2/c1-7-11(25-14(17-7)20-12(15)16)10-6-24-13(19-10)18-8-2-4-9(5-3-8)21(22)23/h2-6H,1H3,(H,18,19)(H4,15,16,17,20) |
| InChIKey | PFCBFEQKASYUCX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|