C26H22N4O — CID 174614684
3-[[4-[1-(2-phenylethyl)indol-3-yl]pyrimidin-2-yl]amino]phenol (PubChem CID 174614684) has the molecular formula C26H22N4O and a molecular weight of 406.49 g/mol. Its IUPAC name is 3-[[4-[1-(2-phenylethyl)indol-3-yl]pyrimidin-2-yl]amino]phenol.
| Compound Name | 3-[[4-[1-(2-phenylethyl)indol-3-yl]pyrimidin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 174614684 |
| Molecular Formula | C26H22N4O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 3-[[4-[1-(2-phenylethyl)indol-3-yl]pyrimidin-2-yl]amino]phenol |
| SMILES | Oc1cccc(Nc2nccc(-c3cn(CCc4ccccc4)c4ccccc34)n2)c1 |
| InChI | InChI=1S/C26H22N4O/c31-21-10-6-9-20(17-21)28-26-27-15-13-24(29-26)23-18-30(25-12-5-4-11-22(23)25)16-14-19-7-2-1-3-8-19/h1-13,15,17-18,31H,14,16H2,(H,27,28,29) |
| InChIKey | YARIQWLHFWOKSR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |