C24H16F3N5O3 — CID 169123677
2-hydroxy-5-[[3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]phenyl]diazenyl]benzoic acid (PubChem CID 169123677) has the molecular formula C24H16F3N5O3 and a molecular weight of 479.42 g/mol. Its IUPAC name is 2-hydroxy-5-[[3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]phenyl]diazenyl]benzoic acid.
| Compound Name | 2-hydroxy-5-[[3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 169123677 |
| Molecular Formula | C24H16F3N5O3 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 2-hydroxy-5-[[3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]phenyl]diazenyl]benzoic acid |
| SMILES | O=C(O)c1cc(/N=N/c2cccc(-c3ccnc(Nc4cccc(C(F)(F)F)c4)n3)c2)ccc1O |
| InChI | InChI=1S/C24H16F3N5O3/c25-24(26,27)15-4-2-5-16(12-15)29-23-28-10-9-20(30-23)14-3-1-6-17(11-14)31-32-18-7-8-21(33)19(13-18)22(34)35/h1-13,33H,(H,34,35)(H,28,29,30)/b32-31+ |
| InChIKey | YQNROBMEZJXWMT-QNEJGDQOSA-N |
| XLogP | 6.73 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|