C18H19ClN8 — CID 140967082
2-[2-[[4-[2-(3-chloroanilino)pyrimidin-4-yl]-2-pyridinyl]amino]ethyl]guanidine (PubChem CID 140967082) has the molecular formula C18H19ClN8 and a molecular weight of 382.86 g/mol. Its IUPAC name is 2-[2-[[4-[2-(3-chloroanilino)pyrimidin-4-yl]-2-pyridinyl]amino]ethyl]guanidine.
| Compound Name | 2-[2-[[4-[2-(3-chloroanilino)pyrimidin-4-yl]-2-pyridinyl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 140967082 |
| Molecular Formula | C18H19ClN8 |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[2-[[4-[2-(3-chloroanilino)pyrimidin-4-yl]-2-pyridinyl]amino]ethyl]guanidine |
| SMILES | NC(N)=NCCNc1cc(-c2ccnc(Nc3cccc(Cl)c3)n2)ccn1 |
| InChI | InChI=1S/C18H19ClN8/c19-13-2-1-3-14(11-13)26-18-25-7-5-15(27-18)12-4-6-22-16(10-12)23-8-9-24-17(20)21/h1-7,10-11H,8-9H2,(H,22,23)(H4,20,21,24)(H,25,26,27) |
| InChIKey | ANYDIFAASZFQNB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 127.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|