C19H20ClN5O — CID 19689540
3-[[4-[2-(5-chloro-2-methylanilino)pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol (PubChem CID 19689540) has the molecular formula C19H20ClN5O and a molecular weight of 369.86 g/mol. Its IUPAC name is 3-[[4-[2-(5-chloro-2-methylanilino)pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol.
| Compound Name | 3-[[4-[2-(5-chloro-2-methylanilino)pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 19689540 |
| Molecular Formula | C19H20ClN5O |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 3-[[4-[2-(5-chloro-2-methylanilino)pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol |
| SMILES | Cc1ccc(Cl)cc1Nc1nccc(-c2ccnc(NCCCO)c2)n1 |
| InChI | InChI=1S/C19H20ClN5O/c1-13-3-4-15(20)12-17(13)25-19-23-9-6-16(24-19)14-5-8-22-18(11-14)21-7-2-10-26/h3-6,8-9,11-12,26H,2,7,10H2,1H3,(H,21,22)(H,23,24,25) |
| InChIKey | LTLSHWQFIXMNKZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|