C19H20ClN5O2 — CID 19689535
3-[[4-[2-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol (PubChem CID 19689535) has the molecular formula C19H20ClN5O2 and a molecular weight of 385.86 g/mol. Its IUPAC name is 3-[[4-[2-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol.
| Compound Name | 3-[[4-[2-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 19689535 |
| Molecular Formula | C19H20ClN5O2 |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 3-[[4-[2-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol |
| SMILES | COc1ccc(Cl)cc1Nc1nccc(-c2ccnc(NCCCO)c2)n1 |
| InChI | InChI=1S/C19H20ClN5O2/c1-27-17-4-3-14(20)12-16(17)25-19-23-9-6-15(24-19)13-5-8-22-18(11-13)21-7-2-10-26/h3-6,8-9,11-12,26H,2,7,10H2,1H3,(H,21,22)(H,23,24,25) |
| InChIKey | VXLVQAZXGZJNNM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|