C18H20ClN5O — CID 163584512
3-[[4-[2-[(5-chlorocyclohexa-1,3-dien-1-yl)amino]pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol (PubChem CID 163584512) has the molecular formula C18H20ClN5O and a molecular weight of 357.85 g/mol. Its IUPAC name is 3-[[4-[2-[(5-chlorocyclohexa-1,3-dien-1-yl)amino]pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol.
| Compound Name | 3-[[4-[2-[(5-chlorocyclohexa-1,3-dien-1-yl)amino]pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 163584512 |
| Molecular Formula | C18H20ClN5O |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-[[4-[2-[(5-chlorocyclohexa-1,3-dien-1-yl)amino]pyrimidin-4-yl]-2-pyridinyl]amino]propan-1-ol |
| SMILES | OCCCNc1cc(-c2ccnc(NC3=CC=CC(Cl)C3)n2)ccn1 |
| InChI | InChI=1S/C18H20ClN5O/c19-14-3-1-4-15(12-14)23-18-22-9-6-16(24-18)13-5-8-21-17(11-13)20-7-2-10-25/h1,3-6,8-9,11,14,25H,2,7,10,12H2,(H,20,21)(H,22,23,24) |
| InChIKey | GKJNWJOONQQDTR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|