C26H30ClN5O2 — CID 58716813
[4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]phenyl]-[4-(4-hydroxybutylamino)piperidin-1-yl]methanone (PubChem CID 58716813) has the molecular formula C26H30ClN5O2 and a molecular weight of 480.01 g/mol. Its IUPAC name is [4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]phenyl]-[4-(4-hydroxybutylamino)piperidin-1-yl]methanone.
| Compound Name | [4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]phenyl]-[4-(4-hydroxybutylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 58716813 |
| Molecular Formula | C26H30ClN5O2 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | [4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]phenyl]-[4-(4-hydroxybutylamino)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Nc2nccc(-c3ccc(Cl)cc3)n2)cc1)N1CCC(NCCCCO)CC1 |
| InChI | InChI=1S/C26H30ClN5O2/c27-21-7-3-19(4-8-21)24-11-15-29-26(31-24)30-23-9-5-20(6-10-23)25(34)32-16-12-22(13-17-32)28-14-1-2-18-33/h3-11,15,22,28,33H,1-2,12-14,16-18H2,(H,29,30,31) |
| InChIKey | XQRPBRUYOXZRKG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|